About (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane
(2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane (PubChem CID 71376459) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane.
Molecular Properties
| Compound Name | (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane |
| PubChem CID | 71376459 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane |
| SMILES | C=CC[C@@H]1OCC[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H16O2/c1-2-6-13-14-10-9-12(15-13)11-7-4-3-5-8-11/h2-5,7-8,12-13H,1,6,9-10H2/t12-,13-/m1/s1 |
| InChIKey | OFFWTFFLOOECTO-CHWSQXEVSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane?
The IUPAC name of (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane (CID 71376459) is (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane.
What is the SMILES notation for (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane?
The canonical SMILES for (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane is C=CC[C@@H]1OCC[C@H](c2ccccc2)O1.
What is the InChIKey of (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane?
The InChIKey is OFFWTFFLOOECTO-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-6-13-14-10-9-12(15-13)11-7-4-3-5-8-11/h2-5,7-8,12-13H,1,6,9-10H2/t12-,13-/m1/s1.
What are the key properties of (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane?
(2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane has a molecular weight of 204.27 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-4-phenyl-2-prop-2-enyl-1,3-dioxane is sourced from PubChem (CID 71376459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).