C16H9Cl2FNO3- — CID 7137651
(E)-2-[(2,4-dichlorobenzoyl)amino]-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7137651) has the molecular formula C16H9Cl2FNO3- and a molecular weight of 353.16 g/mol. Its IUPAC name is (E)-2-[(2,4-dichlorobenzoyl)amino]-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | (E)-2-[(2,4-dichlorobenzoyl)amino]-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7137651 |
| Molecular Formula | C16H9Cl2FNO3- |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (E)-2-[(2,4-dichlorobenzoyl)amino]-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C(=C\c1ccccc1F)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl2FNO3/c17-10-5-6-11(12(18)8-10)15(21)20-14(16(22)23)7-9-3-1-2-4-13(9)19/h1-8H,(H,20,21)(H,22,23)/p-1/b14-7+ |
| InChIKey | UTBLMKKXYMTTJG-VGOFMYFVSA-M |
| XLogP | 2.65 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|