C13H13F3N+ — CID 71376887
4-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridin-1-ium (PubChem CID 71376887) has the molecular formula C13H13F3N+ and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridin-1-ium.
| Compound Name | 4-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 71376887 |
| Molecular Formula | C13H13F3N+ |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridin-1-ium |
| SMILES | FC(F)(F)C[N+]1=CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H13F3N/c14-13(15,16)10-17-8-6-12(7-9-17)11-4-2-1-3-5-11/h1-6,8H,7,9-10H2/q+1 |
| InChIKey | FDLMZQSHASVLRT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|