C22H38O2P+ — CID 71377578
tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium (PubChem CID 71377578) has the molecular formula C22H38O2P+ and a molecular weight of 365.52 g/mol. Its IUPAC name is tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium.
| Compound Name | tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium |
|---|---|
| PubChem CID | 71377578 |
| Molecular Formula | C22H38O2P+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C22H38O2P/c1-4-7-16-25(17-8-5-2,18-9-6-3)19-20-10-12-21(13-11-20)22-23-14-15-24-22/h10-13,22H,4-9,14-19H2,1-3H3/q+1 |
| InChIKey | FUMOWTSLKNHMCM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|