About tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium
tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium (PubChem CID 71377578) has the molecular formula C22H38O2P+
and a molecular weight of 365.52 g/mol. Its IUPAC name is tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium.
Molecular Properties
| Compound Name | tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium |
| PubChem CID | 71377578 |
| Molecular Formula | C22H38O2P+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C22H38O2P/c1-4-7-16-25(17-8-5-2,18-9-6-3)19-20-10-12-21(13-11-20)22-23-14-15-24-22/h10-13,22H,4-9,14-19H2,1-3H3/q+1 |
| InChIKey | FUMOWTSLKNHMCM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium?
The IUPAC name of tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium (CID 71377578) is tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium.
What is the SMILES notation for tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium?
The canonical SMILES for tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium is CCCC[P+](CCCC)(CCCC)Cc1ccc(C2OCCO2)cc1.
What is the InChIKey of tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium?
The InChIKey is FUMOWTSLKNHMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O2P/c1-4-7-16-25(17-8-5-2,18-9-6-3)19-20-10-12-21(13-11-20)22-23-14-15-24-22/h10-13,22H,4-9,14-19H2,1-3H3/q+1.
What are the key properties of tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium?
tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium has a molecular weight of 365.52 g/mol, XLogP of 6.65, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[[4-(1,3-dioxolan-2-yl)phenyl]methyl]phosphanium is sourced from PubChem (CID 71377578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).