C16H26O3S2 — CID 71377654
(2S,3S)-1-(benzenesulfonyl)-2-butylsulfanylhexan-3-ol (PubChem CID 71377654) has the molecular formula C16H26O3S2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (2S,3S)-1-(benzenesulfonyl)-2-butylsulfanylhexan-3-ol.
| Compound Name | (2S,3S)-1-(benzenesulfonyl)-2-butylsulfanylhexan-3-ol |
|---|---|
| PubChem CID | 71377654 |
| Molecular Formula | C16H26O3S2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2S,3S)-1-(benzenesulfonyl)-2-butylsulfanylhexan-3-ol |
| SMILES | CCCCS[C@H](CS(=O)(=O)c1ccccc1)[C@@H](O)CCC |
| InChI | InChI=1S/C16H26O3S2/c1-3-5-12-20-16(15(17)9-4-2)13-21(18,19)14-10-7-6-8-11-14/h6-8,10-11,15-17H,3-5,9,12-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | GHZAECJULIGZQL-JKSUJKDBSA-N |
| XLogP | 3.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|