C15H25F9N+ — CID 71377731
3,3,4,4,5,5,6,6,6-nonafluorohexyl(tripropyl)azanium (PubChem CID 71377731) has the molecular formula C15H25F9N+ and a molecular weight of 390.35 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl(tripropyl)azanium.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl(tripropyl)azanium |
|---|---|
| PubChem CID | 71377731 |
| Molecular Formula | C15H25F9N+ |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl(tripropyl)azanium |
| SMILES | CCC[N+](CCC)(CCC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H25F9N/c1-4-8-25(9-5-2,10-6-3)11-7-12(16,17)13(18,19)14(20,21)15(22,23)24/h4-11H2,1-3H3/q+1 |
| InChIKey | WIWXQAJUJWSYJL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|