About tripropoxysilane
tripropoxysilane (PubChem CID 71378233) has the molecular formula C9H22O3Si
and a molecular weight of 206.36 g/mol. Its IUPAC name is tripropoxysilane.
Molecular Properties
| Compound Name | tripropoxysilane |
| PubChem CID | 71378233 |
| Molecular Formula | C9H22O3Si |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | tripropoxysilane |
| SMILES | CCCO[SiH](OCCC)OCCC |
| InChI | InChI=1S/C9H22O3Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h13H,4-9H2,1-3H3 |
| InChIKey | OZWKZRFXJPGDFM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tripropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripropoxysilane?
The IUPAC name of tripropoxysilane (CID 71378233) is tripropoxysilane.
What is the SMILES notation for tripropoxysilane?
The canonical SMILES for tripropoxysilane is CCCO[SiH](OCCC)OCCC.
What is the InChIKey of tripropoxysilane?
The InChIKey is OZWKZRFXJPGDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h13H,4-9H2,1-3H3.
What are the key properties of tripropoxysilane?
tripropoxysilane has a molecular weight of 206.36 g/mol, XLogP of 1.98, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tripropoxysilane is sourced from PubChem (CID 71378233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).