C17H16N2OS — CID 713788
4,5,6-trimethyl-2-phenacylsulfanylpyridine-3-carbonitrile (PubChem CID 713788) has the molecular formula C17H16N2OS and a molecular weight of 296.39 g/mol. Its IUPAC name is 4,5,6-trimethyl-2-phenacylsulfanylpyridine-3-carbonitrile.
| Compound Name | 4,5,6-trimethyl-2-phenacylsulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 713788 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4,5,6-trimethyl-2-phenacylsulfanylpyridine-3-carbonitrile |
| SMILES | Cc1nc(SCC(=O)c2ccccc2)c(C#N)c(C)c1C |
| InChI | InChI=1S/C17H16N2OS/c1-11-12(2)15(9-18)17(19-13(11)3)21-10-16(20)14-7-5-4-6-8-14/h4-8H,10H2,1-3H3 |
| InChIKey | OESVEFLEJFXDCW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |