About N-tert-butyl-2,2-dimethylpent-4-enamide
N-tert-butyl-2,2-dimethylpent-4-enamide (PubChem CID 71378995) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethylpent-4-enamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-dimethylpent-4-enamide |
| PubChem CID | 71378995 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-tert-butyl-2,2-dimethylpent-4-enamide |
| SMILES | C=CCC(C)(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H21NO/c1-7-8-11(5,6)9(13)12-10(2,3)4/h7H,1,8H2,2-6H3,(H,12,13) |
| InChIKey | VRWFZYDKZYCDLU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,2-dimethylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-dimethylpent-4-enamide?
The IUPAC name of N-tert-butyl-2,2-dimethylpent-4-enamide (CID 71378995) is N-tert-butyl-2,2-dimethylpent-4-enamide.
What is the SMILES notation for N-tert-butyl-2,2-dimethylpent-4-enamide?
The canonical SMILES for N-tert-butyl-2,2-dimethylpent-4-enamide is C=CCC(C)(C)C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2,2-dimethylpent-4-enamide?
The InChIKey is VRWFZYDKZYCDLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-7-8-11(5,6)9(13)12-10(2,3)4/h7H,1,8H2,2-6H3,(H,12,13).
What are the key properties of N-tert-butyl-2,2-dimethylpent-4-enamide?
N-tert-butyl-2,2-dimethylpent-4-enamide has a molecular weight of 183.29 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-dimethylpent-4-enamide is sourced from PubChem (CID 71378995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).