About 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal
6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal (PubChem CID 71379096) has the molecular formula C16H20OS2
and a molecular weight of 292.47 g/mol. Its IUPAC name is 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal.
Molecular Properties
| Compound Name | 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal |
| PubChem CID | 71379096 |
| Molecular Formula | C16H20OS2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal |
| SMILES | CSC(=CC=O)C(=CC(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C16H20OS2/c1-16(2,3)12-15(14(18-4)10-11-17)19-13-8-6-5-7-9-13/h5-12H,1-4H3 |
| InChIKey | NLCWSYWUCMGJGY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal?
The IUPAC name of 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal (CID 71379096) is 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal.
What is the SMILES notation for 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal?
The canonical SMILES for 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal is CSC(=CC=O)C(=CC(C)(C)C)Sc1ccccc1.
What is the InChIKey of 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal?
The InChIKey is NLCWSYWUCMGJGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20OS2/c1-16(2,3)12-15(14(18-4)10-11-17)19-13-8-6-5-7-9-13/h5-12H,1-4H3.
What are the key properties of 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal?
6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal has a molecular weight of 292.47 g/mol, XLogP of 5.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-3-methylsulfanyl-4-phenylsulfanylhepta-2,4-dienal is sourced from PubChem (CID 71379096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).