About methanol;(1R)-1-methyl-3-methylidenecyclohexane
methanol;(1R)-1-methyl-3-methylidenecyclohexane (PubChem CID 71379191) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is methanol;(1R)-1-methyl-3-methylidenecyclohexane.
Molecular Properties
| Compound Name | methanol;(1R)-1-methyl-3-methylidenecyclohexane |
| PubChem CID | 71379191 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | methanol;(1R)-1-methyl-3-methylidenecyclohexane |
| SMILES | C=C1CCC[C@@H](C)C1.CO |
| InChI | InChI=1S/C8H14.CH4O/c1-7-4-3-5-8(2)6-7;1-2/h8H,1,3-6H2,2H3;2H,1H3/t8-;/m1./s1 |
| InChIKey | WVCLFCKDWWBJTA-DDWIOCJRSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanol;(1R)-1-methyl-3-methylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(1R)-1-methyl-3-methylidenecyclohexane?
The IUPAC name of methanol;(1R)-1-methyl-3-methylidenecyclohexane (CID 71379191) is methanol;(1R)-1-methyl-3-methylidenecyclohexane.
What is the SMILES notation for methanol;(1R)-1-methyl-3-methylidenecyclohexane?
The canonical SMILES for methanol;(1R)-1-methyl-3-methylidenecyclohexane is C=C1CCC[C@@H](C)C1.CO.
What is the InChIKey of methanol;(1R)-1-methyl-3-methylidenecyclohexane?
The InChIKey is WVCLFCKDWWBJTA-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H14.CH4O/c1-7-4-3-5-8(2)6-7;1-2/h8H,1,3-6H2,2H3;2H,1H3/t8-;/m1./s1.
What are the key properties of methanol;(1R)-1-methyl-3-methylidenecyclohexane?
methanol;(1R)-1-methyl-3-methylidenecyclohexane has a molecular weight of 142.24 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(1R)-1-methyl-3-methylidenecyclohexane is sourced from PubChem (CID 71379191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).