C11F22O — CID 71380340
2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane (PubChem CID 71380340) has the molecular formula C11F22O and a molecular weight of 566.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane.
| Compound Name | 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane |
|---|---|
| PubChem CID | 71380340 |
| Molecular Formula | C11F22O |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F22O/c12-1(13,3(16,17)7(24,25)10(29,30)31)2(14,15)5(20,21)9(28)6(22,23)4(18,19)8(26,27)11(32,33)34-9 |
| InChIKey | CBUDGIQWHQHTHD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|