About 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione
5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione (PubChem CID 71380707) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione |
| PubChem CID | 71380707 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione |
| SMILES | CCC(=O)C1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C9H13NO3/c1-4-5(11)6-7(12)9(2,3)10-8(6)13/h6H,4H2,1-3H3,(H,10,13) |
| InChIKey | MXYYJKKZQOARNO-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione (CID 71380707) is 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione is CCC(=O)C1C(=O)NC(C)(C)C1=O.
What is the InChIKey of 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione?
The InChIKey is MXYYJKKZQOARNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-4-5(11)6-7(12)9(2,3)10-8(6)13/h6H,4H2,1-3H3,(H,10,13).
What are the key properties of 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione?
5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione has a molecular weight of 183.21 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-propanoylpyrrolidine-2,4-dione is sourced from PubChem (CID 71380707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).