C23H30ClNO4 — CID 71381231
N-[2,5-bis(3-methylbutoxy)phenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 71381231) has the molecular formula C23H30ClNO4 and a molecular weight of 419.95 g/mol. Its IUPAC name is N-[2,5-bis(3-methylbutoxy)phenyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[2,5-bis(3-methylbutoxy)phenyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71381231 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[2,5-bis(3-methylbutoxy)phenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | CC(C)CCOc1ccc(OCCC(C)C)c(NC(=O)c2cc(Cl)ccc2O)c1 |
| InChI | InChI=1S/C23H30ClNO4/c1-15(2)9-11-28-18-6-8-22(29-12-10-16(3)4)20(14-18)25-23(27)19-13-17(24)5-7-21(19)26/h5-8,13-16,26H,9-12H2,1-4H3,(H,25,27) |
| InChIKey | NNVGYGAOJRUNHG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |