About benzene-1,2-diamine;benzoic acid
benzene-1,2-diamine;benzoic acid (PubChem CID 71381436) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is benzene-1,2-diamine;benzoic acid.
Molecular Properties
| Compound Name | benzene-1,2-diamine;benzoic acid |
| PubChem CID | 71381436 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | benzene-1,2-diamine;benzoic acid |
| SMILES | Nc1ccccc1N.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/2C7H6O2.C6H8N2/c2*8-7(9)6-4-2-1-3-5-6;7-5-3-1-2-4-6(5)8/h2*1-5H,(H,8,9);1-4H,7-8H2 |
| InChIKey | CDINKCFZXDDTHP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;benzoic acid?
The IUPAC name of benzene-1,2-diamine;benzoic acid (CID 71381436) is benzene-1,2-diamine;benzoic acid.
What is the SMILES notation for benzene-1,2-diamine;benzoic acid?
The canonical SMILES for benzene-1,2-diamine;benzoic acid is Nc1ccccc1N.O=C(O)c1ccccc1.O=C(O)c1ccccc1.
What is the InChIKey of benzene-1,2-diamine;benzoic acid?
The InChIKey is CDINKCFZXDDTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6O2.C6H8N2/c2*8-7(9)6-4-2-1-3-5-6;7-5-3-1-2-4-6(5)8/h2*1-5H,(H,8,9);1-4H,7-8H2.
What are the key properties of benzene-1,2-diamine;benzoic acid?
benzene-1,2-diamine;benzoic acid has a molecular weight of 352.39 g/mol, XLogP of 3.62, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;benzoic acid is sourced from PubChem (CID 71381436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).