About 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate
2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate (PubChem CID 71381790) has the molecular formula C8H9F3O3
and a molecular weight of 210.15 g/mol. Its IUPAC name is 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 71381790 |
| Molecular Formula | C8H9F3O3 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate |
| SMILES | CC(C)COC(=O)C(=C=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O3/c1-5(2)4-14-7(13)6(3-12)8(9,10)11/h5H,4H2,1-2H3 |
| InChIKey | ZOSKXPLVGAXBFJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate (CID 71381790) is 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate is CC(C)COC(=O)C(=C=O)C(F)(F)F.
What is the InChIKey of 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate?
The InChIKey is ZOSKXPLVGAXBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O3/c1-5(2)4-14-7(13)6(3-12)8(9,10)11/h5H,4H2,1-2H3.
What are the key properties of 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate?
2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate has a molecular weight of 210.15 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-oxo-2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 71381790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).