C22H10Br2N4 — CID 71381944
3,4-bis(4-bromophenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile (PubChem CID 71381944) has the molecular formula C22H10Br2N4 and a molecular weight of 490.16 g/mol. Its IUPAC name is 3,4-bis(4-bromophenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile.
| Compound Name | 3,4-bis(4-bromophenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile |
|---|---|
| PubChem CID | 71381944 |
| Molecular Formula | C22H10Br2N4 |
| Molecular Weight | 490.16 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | 3,4-bis(4-bromophenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile |
| SMILES | N#CC(C#N)=CC(=C(C=C(C#N)C#N)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H10Br2N4/c23-19-5-1-17(2-6-19)21(9-15(11-25)12-26)22(10-16(13-27)14-28)18-3-7-20(24)8-4-18/h1-10H |
| InChIKey | ZWIFRQYDWOLQTL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.16 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|