About N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide
N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide (PubChem CID 71382235) has the molecular formula C9H13ClN2O2
and a molecular weight of 216.67 g/mol. Its IUPAC name is N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide.
Molecular Properties
| Compound Name | N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide |
| PubChem CID | 71382235 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide |
| SMILES | CC1(C)C(=N[N+](=O)[O-])C2(Cl)CCC1C2 |
| InChI | InChI=1S/C9H13ClN2O2/c1-8(2)6-3-4-9(10,5-6)7(8)11-12(13)14/h6H,3-5H2,1-2H3 |
| InChIKey | HJKNNLFHTCWVEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide?
The IUPAC name of N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide (CID 71382235) is N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide.
What is the SMILES notation for N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide?
The canonical SMILES for N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide is CC1(C)C(=N[N+](=O)[O-])C2(Cl)CCC1C2.
What is the InChIKey of N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide?
The InChIKey is HJKNNLFHTCWVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O2/c1-8(2)6-3-4-9(10,5-6)7(8)11-12(13)14/h6H,3-5H2,1-2H3.
What are the key properties of N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide?
N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide has a molecular weight of 216.67 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)nitramide is sourced from PubChem (CID 71382235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).