C15H10Cl2N2O3 — CID 71382635
(3-cyanophenyl) 2-[(2,6-dichloro-3-pyridinyl)oxy]propanoate (PubChem CID 71382635) has the molecular formula C15H10Cl2N2O3 and a molecular weight of 337.16 g/mol. Its IUPAC name is (3-cyanophenyl) 2-[(2,6-dichloro-3-pyridinyl)oxy]propanoate.
| Compound Name | (3-cyanophenyl) 2-[(2,6-dichloro-3-pyridinyl)oxy]propanoate |
|---|---|
| PubChem CID | 71382635 |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (3-cyanophenyl) 2-[(2,6-dichloro-3-pyridinyl)oxy]propanoate |
| SMILES | CC(Oc1ccc(Cl)nc1Cl)C(=O)Oc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H10Cl2N2O3/c1-9(21-12-5-6-13(16)19-14(12)17)15(20)22-11-4-2-3-10(7-11)8-18/h2-7,9H,1H3 |
| InChIKey | HOQJRTHYPFFURA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|