C10H6F7N — CID 71382954
2,2,3,3,4,4,4-heptafluoro-N-phenylbutan-1-imine (PubChem CID 71382954) has the molecular formula C10H6F7N and a molecular weight of 273.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-phenylbutan-1-imine.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-phenylbutan-1-imine |
|---|---|
| PubChem CID | 71382954 |
| Molecular Formula | C10H6F7N |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-phenylbutan-1-imine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)/C=N/c1ccccc1 |
| InChI | InChI=1S/C10H6F7N/c11-8(12,9(13,14)10(15,16)17)6-18-7-4-2-1-3-5-7/h1-6H/b18-6+ |
| InChIKey | ZLEJZFMXNQLLHM-NGYBGAFCSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|