About 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium
1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium (PubChem CID 71383074) has the molecular formula C6H14N2O3P+
and a molecular weight of 193.16 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium |
| PubChem CID | 71383074 |
| Molecular Formula | C6H14N2O3P+ |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium |
| SMILES | C1CN2CCN1CC2.O=[P+](O)O |
| InChI | InChI=1S/C6H12N2.HO3P/c1-2-8-5-3-7(1)4-6-8;1-4(2)3/h1-6H2;(H-,1,2,3)/p+1 |
| InChIKey | UGOWBDOJQBDRBT-UHFFFAOYSA-O |
| XLogP | -0.75 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium (CID 71383074) is 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium is C1CN2CCN1CC2.O=[P+](O)O.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium?
The InChIKey is UGOWBDOJQBDRBT-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H12N2.HO3P/c1-2-8-5-3-7(1)4-6-8;1-4(2)3/h1-6H2;(H-,1,2,3)/p+1.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium?
1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium has a molecular weight of 193.16 g/mol, XLogP of -0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;dihydroxy(oxo)phosphanium is sourced from PubChem (CID 71383074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).