About 4-chlorohept-3-ene
4-chlorohept-3-ene (PubChem CID 71383203) has the molecular formula C7H13Cl
and a molecular weight of 132.63 g/mol. Its IUPAC name is 4-chlorohept-3-ene.
Molecular Properties
| Compound Name | 4-chlorohept-3-ene |
| PubChem CID | 71383203 |
| Molecular Formula | C7H13Cl |
| Molecular Weight | 132.63 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 4-chlorohept-3-ene |
| SMILES | CCC=C(Cl)CCC |
| InChI | InChI=1S/C7H13Cl/c1-3-5-7(8)6-4-2/h5H,3-4,6H2,1-2H3 |
| InChIKey | IHVCWNOYIUYQAM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-chlorohept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorohept-3-ene?
The IUPAC name of 4-chlorohept-3-ene (CID 71383203) is 4-chlorohept-3-ene.
What is the SMILES notation for 4-chlorohept-3-ene?
The canonical SMILES for 4-chlorohept-3-ene is CCC=C(Cl)CCC.
What is the InChIKey of 4-chlorohept-3-ene?
The InChIKey is IHVCWNOYIUYQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Cl/c1-3-5-7(8)6-4-2/h5H,3-4,6H2,1-2H3.
What are the key properties of 4-chlorohept-3-ene?
4-chlorohept-3-ene has a molecular weight of 132.63 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorohept-3-ene is sourced from PubChem (CID 71383203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).