C9H13N5O9 — CID 71383820
1,3-bis(ethoxycarbonylamino)-1,3-dioxopropane-2-diazonium nitrate (PubChem CID 71383820) has the molecular formula C9H13N5O9 and a molecular weight of 335.23 g/mol. Its IUPAC name is 1,3-bis(ethoxycarbonylamino)-1,3-dioxopropane-2-diazonium nitrate.
| Compound Name | 1,3-bis(ethoxycarbonylamino)-1,3-dioxopropane-2-diazonium nitrate |
|---|---|
| PubChem CID | 71383820 |
| Molecular Formula | C9H13N5O9 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1,3-bis(ethoxycarbonylamino)-1,3-dioxopropane-2-diazonium nitrate |
| SMILES | CCOC(=O)NC(=O)C([N+]#N)C(=O)NC(=O)OCC.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C9H12N4O6.NO3/c1-3-18-8(16)11-6(14)5(13-10)7(15)12-9(17)19-4-2;2-1(3)4/h5H,3-4H2,1-2H3,(H-,11,12,14,15,16,17);/q;-1/p+1 |
| InChIKey | KJSPLIDJNBEUKG-UHFFFAOYSA-O |
| XLogP | -0.49 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|