C20H37N3O4Sn — CID 71383917
diethyl 2-tributylstannyltriazole-4,5-dicarboxylate (PubChem CID 71383917) has the molecular formula C20H37N3O4Sn and a molecular weight of 502.24 g/mol. Its IUPAC name is diethyl 2-tributylstannyltriazole-4,5-dicarboxylate.
| Compound Name | diethyl 2-tributylstannyltriazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 71383917 |
| Molecular Formula | C20H37N3O4Sn |
| Molecular Weight | 502.24 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | diethyl 2-tributylstannyltriazole-4,5-dicarboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)n1nc(C(=O)OCC)c(C(=O)OCC)n1 |
| InChI | InChI=1S/C8H11N3O4.3C4H9.Sn/c1-3-14-7(12)5-6(10-11-9-5)8(13)15-4-2;3*1-3-4-2;/h3-4H2,1-2H3,(H,9,10,11,12,13);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | LBWPSDGKNHOTCK-UHFFFAOYSA-M |
| XLogP | 4.83 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |