About 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane
6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane (PubChem CID 71383959) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 71383959 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1CCCCC12OCC(c1ccccc1)O2 |
| InChI | InChI=1S/C15H20O2/c1-12-7-5-6-10-15(12)16-11-14(17-15)13-8-3-2-4-9-13/h2-4,8-9,12,14H,5-7,10-11H2,1H3 |
| InChIKey | VDHOJIYJIBOPCR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane (CID 71383959) is 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane is CC1CCCCC12OCC(c1ccccc1)O2.
What is the InChIKey of 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is VDHOJIYJIBOPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-12-7-5-6-10-15(12)16-11-14(17-15)13-8-3-2-4-9-13/h2-4,8-9,12,14H,5-7,10-11H2,1H3.
What are the key properties of 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane?
6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 232.32 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-phenyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 71383959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).