About 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one
4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one (PubChem CID 71384012) has the molecular formula C25H17NO4
and a molecular weight of 395.41 g/mol. Its IUPAC name is 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one |
| PubChem CID | 71384012 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one |
| SMILES | O=c1oc2nc3ccccc3c(OCc3ccccc3)c2c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C25H17NO4/c27-22-20(17-11-5-2-6-12-17)25(28)30-24-21(22)23(18-13-7-8-14-19(18)26-24)29-15-16-9-3-1-4-10-16/h1-14,27H,15H2 |
| InChIKey | MDNNDORLAXNOQP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one?
The IUPAC name of 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one (CID 71384012) is 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one.
What is the SMILES notation for 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one?
The canonical SMILES for 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one is O=c1oc2nc3ccccc3c(OCc3ccccc3)c2c(O)c1-c1ccccc1.
What is the InChIKey of 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one?
The InChIKey is MDNNDORLAXNOQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17NO4/c27-22-20(17-11-5-2-6-12-17)25(28)30-24-21(22)23(18-13-7-8-14-19(18)26-24)29-15-16-9-3-1-4-10-16/h1-14,27H,15H2.
What are the key properties of 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one?
4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one has a molecular weight of 395.41 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-phenyl-5-phenylmethoxypyrano[2,3-b]quinolin-2-one is sourced from PubChem (CID 71384012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).