About 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene
9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene (PubChem CID 71384029) has the molecular formula C30H24O2
and a molecular weight of 416.52 g/mol. Its IUPAC name is 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene.
Molecular Properties
| Compound Name | 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene |
| PubChem CID | 71384029 |
| Molecular Formula | C30H24O2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene |
| SMILES | Cc1cc(C)c2c(c1)C(=C1c3ccccc3Oc3c(C)cc(C)cc31)c1ccccc1O2 |
| InChI | InChI=1S/C30H24O2/c1-17-13-19(3)29-23(15-17)27(21-9-5-7-11-25(21)31-29)28-22-10-6-8-12-26(22)32-30-20(4)14-18(2)16-24(28)30/h5-16H,1-4H3 |
| InChIKey | SSEVTBRPYQOOMA-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene?
The IUPAC name of 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene (CID 71384029) is 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene.
What is the SMILES notation for 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene?
The canonical SMILES for 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene is Cc1cc(C)c2c(c1)C(=C1c3ccccc3Oc3c(C)cc(C)cc31)c1ccccc1O2.
What is the InChIKey of 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene?
The InChIKey is SSEVTBRPYQOOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24O2/c1-17-13-19(3)29-23(15-17)27(21-9-5-7-11-25(21)31-29)28-22-10-6-8-12-26(22)32-30-20(4)14-18(2)16-24(28)30/h5-16H,1-4H3.
What are the key properties of 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene?
9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene has a molecular weight of 416.52 g/mol, XLogP of 8.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,4-dimethylxanthen-9-ylidene)-2,4-dimethylxanthene is sourced from PubChem (CID 71384029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).