C11H8F7NO2 — CID 71384122
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-N-phenylacetamide (PubChem CID 71384122) has the molecular formula C11H8F7NO2 and a molecular weight of 319.18 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-N-phenylacetamide.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-N-phenylacetamide |
|---|---|
| PubChem CID | 71384122 |
| Molecular Formula | C11H8F7NO2 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)-N-phenylacetamide |
| SMILES | O=C(COC(F)(C(F)(F)F)C(F)(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C11H8F7NO2/c12-9(10(13,14)15,11(16,17)18)21-6-8(20)19-7-4-2-1-3-5-7/h1-5H,6H2,(H,19,20) |
| InChIKey | AULFSFAAKNRJFT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |