C7H11Br4Cl — CID 71384171
1,1,1,3-tetrabromo-4-chloro-4-methylhexane (PubChem CID 71384171) has the molecular formula C7H11Br4Cl and a molecular weight of 450.23 g/mol. Its IUPAC name is 1,1,1,3-tetrabromo-4-chloro-4-methylhexane.
| Compound Name | 1,1,1,3-tetrabromo-4-chloro-4-methylhexane |
|---|---|
| PubChem CID | 71384171 |
| Molecular Formula | C7H11Br4Cl |
| Molecular Weight | 450.23 g/mol |
| Exact Mass | 445.73 |
| IUPAC Name | 1,1,1,3-tetrabromo-4-chloro-4-methylhexane |
| SMILES | CCC(C)(Cl)C(Br)CC(Br)(Br)Br |
| InChI | InChI=1S/C7H11Br4Cl/c1-3-6(2,12)5(8)4-7(9,10)11/h5H,3-4H2,1-2H3 |
| InChIKey | VIOHYUIAXOUPIQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|