About 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid
2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid (PubChem CID 71384371) has the molecular formula C24H24Br2N2O2
and a molecular weight of 532.28 g/mol. Its IUPAC name is 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid.
Molecular Properties
| Compound Name | 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid |
| PubChem CID | 71384371 |
| Molecular Formula | C24H24Br2N2O2 |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2cc(Br)c(Br)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H24Br2N2O2/c1-27(2)17-9-5-15(6-10-17)23(16-7-11-18(12-8-16)28(3)4)19-13-21(25)22(26)14-20(19)24(29)30/h5-14,23H,1-4H3,(H,29,30) |
| InChIKey | KTKDWVCMPSEFQY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid?
The IUPAC name of 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid (CID 71384371) is 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid.
What is the SMILES notation for 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid?
The canonical SMILES for 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid is CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2cc(Br)c(Br)cc2C(=O)O)cc1.
What is the InChIKey of 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid?
The InChIKey is KTKDWVCMPSEFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Br2N2O2/c1-27(2)17-9-5-15(6-10-17)23(16-7-11-18(12-8-16)28(3)4)19-13-21(25)22(26)14-20(19)24(29)30/h5-14,23H,1-4H3,(H,29,30).
What are the key properties of 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid?
2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid has a molecular weight of 532.28 g/mol, XLogP of 6.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[4-(dimethylamino)phenyl]methyl]-4,5-dibromobenzoic acid is sourced from PubChem (CID 71384371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).