C9H2Cl3F3N2O2S2 — CID 71384567
2-(2,4,5-trichlorophenyl)sulfonyl-5-(trifluoromethyl)-1,3,4-thiadiazole (PubChem CID 71384567) has the molecular formula C9H2Cl3F3N2O2S2 and a molecular weight of 397.61 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenyl)sulfonyl-5-(trifluoromethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(2,4,5-trichlorophenyl)sulfonyl-5-(trifluoromethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 71384567 |
| Molecular Formula | C9H2Cl3F3N2O2S2 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | 2-(2,4,5-trichlorophenyl)sulfonyl-5-(trifluoromethyl)-1,3,4-thiadiazole |
| SMILES | O=S(=O)(c1nnc(C(F)(F)F)s1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H2Cl3F3N2O2S2/c10-3-1-5(12)6(2-4(3)11)21(18,19)8-17-16-7(20-8)9(13,14)15/h1-2H |
| InChIKey | CUMRTMGHXJDQRY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|