About 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole
2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole (PubChem CID 71384568) has the molecular formula C9H3Cl2F3N2OS2
and a molecular weight of 347.17 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole |
| PubChem CID | 71384568 |
| Molecular Formula | C9H3Cl2F3N2OS2 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole |
| SMILES | O=S(c1ccc(Cl)c(Cl)c1)c1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H3Cl2F3N2OS2/c10-5-2-1-4(3-6(5)11)19(17)8-16-15-7(18-8)9(12,13)14/h1-3H |
| InChIKey | KWGLSDCGDGEJLB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole?
The IUPAC name of 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole (CID 71384568) is 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole is O=S(c1ccc(Cl)c(Cl)c1)c1nnc(C(F)(F)F)s1.
What is the InChIKey of 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole?
The InChIKey is KWGLSDCGDGEJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Cl2F3N2OS2/c10-5-2-1-4(3-6(5)11)19(17)8-16-15-7(18-8)9(12,13)14/h1-3H.
What are the key properties of 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole?
2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole has a molecular weight of 347.17 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)sulfinyl-5-(trifluoromethyl)-1,3,4-thiadiazole is sourced from PubChem (CID 71384568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).