About 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione
1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione (PubChem CID 71384876) has the molecular formula C18H13N3O3S
and a molecular weight of 351.39 g/mol. Its IUPAC name is 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione |
| PubChem CID | 71384876 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione |
| SMILES | COc1cc(Nc2nccs2)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H13N3O3S/c1-24-12-8-11(21-18-20-6-7-25-18)13-14(15(12)19)17(23)10-5-3-2-4-9(10)16(13)22/h2-8H,19H2,1H3,(H,20,21) |
| InChIKey | KWABWPFXUQZDFM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione?
The IUPAC name of 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione (CID 71384876) is 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione.
What is the SMILES notation for 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione?
The canonical SMILES for 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione is COc1cc(Nc2nccs2)c2c(c1N)C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione?
The InChIKey is KWABWPFXUQZDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O3S/c1-24-12-8-11(21-18-20-6-7-25-18)13-14(15(12)19)17(23)10-5-3-2-4-9(10)16(13)22/h2-8H,19H2,1H3,(H,20,21).
What are the key properties of 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione?
1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione has a molecular weight of 351.39 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-methoxy-4-(1,3-thiazol-2-ylamino)anthracene-9,10-dione is sourced from PubChem (CID 71384876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).