About 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride
7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride (PubChem CID 71385140) has the molecular formula C9H16ClNS
and a molecular weight of 205.75 g/mol. Its IUPAC name is 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride.
Molecular Properties
| Compound Name | 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride |
| PubChem CID | 71385140 |
| Molecular Formula | C9H16ClNS |
| Molecular Weight | 205.75 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride |
| SMILES | CN1C2CCC3SC(C2)CC31.Cl |
| InChI | InChI=1S/C9H15NS.ClH/c1-10-6-2-3-9-8(10)5-7(4-6)11-9;/h6-9H,2-5H2,1H3;1H |
| InChIKey | UTSBSPBWQDVZEN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.75 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride?
The IUPAC name of 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride (CID 71385140) is 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride.
What is the SMILES notation for 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride?
The canonical SMILES for 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride is CN1C2CCC3SC(C2)CC31.Cl.
What is the InChIKey of 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride?
The InChIKey is UTSBSPBWQDVZEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS.ClH/c1-10-6-2-3-9-8(10)5-7(4-6)11-9;/h6-9H,2-5H2,1H3;1H.
What are the key properties of 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride?
7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride has a molecular weight of 205.75 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-thia-7-azatricyclo[4.3.1.03,8]decane;hydrochloride is sourced from PubChem (CID 71385140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).