About 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide
1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide (PubChem CID 71385566) has the molecular formula C12H15NO3S
and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide |
| PubChem CID | 71385566 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide |
| SMILES | CCC1(C(N)=O)c2ccccc2CCS1(=O)=O |
| InChI | InChI=1S/C12H15NO3S/c1-2-12(11(13)14)10-6-4-3-5-9(10)7-8-17(12,15)16/h3-6H,2,7-8H2,1H3,(H2,13,14) |
| InChIKey | OXNNZZWEPPQDGL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide?
The IUPAC name of 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide (CID 71385566) is 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide.
What is the SMILES notation for 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide?
The canonical SMILES for 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide is CCC1(C(N)=O)c2ccccc2CCS1(=O)=O.
What is the InChIKey of 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide?
The InChIKey is OXNNZZWEPPQDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3S/c1-2-12(11(13)14)10-6-4-3-5-9(10)7-8-17(12,15)16/h3-6H,2,7-8H2,1H3,(H2,13,14).
What are the key properties of 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide?
1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide has a molecular weight of 253.32 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,2-dioxo-3,4-dihydroisothiochromene-1-carboxamide is sourced from PubChem (CID 71385566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).