About (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one
(3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one (PubChem CID 71385795) has the molecular formula C21H16ClNO
and a molecular weight of 333.82 g/mol. Its IUPAC name is (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one |
| PubChem CID | 71385795 |
| Molecular Formula | C21H16ClNO |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one |
| SMILES | O=C1[C@@H](c2ccccc2)[C@H](c2ccc(Cl)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H16ClNO/c22-17-13-11-16(12-14-17)20-19(15-7-3-1-4-8-15)21(24)23(20)18-9-5-2-6-10-18/h1-14,19-20H/t19-,20-/m0/s1 |
| InChIKey | UGQJRFLOOOJDEN-PMACEKPBSA-N |
| XLogP | 5.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one?
The IUPAC name of (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one (CID 71385795) is (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one.
What is the SMILES notation for (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one?
The canonical SMILES for (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one is O=C1[C@@H](c2ccccc2)[C@H](c2ccc(Cl)cc2)N1c1ccccc1.
What is the InChIKey of (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one?
The InChIKey is UGQJRFLOOOJDEN-PMACEKPBSA-N. The full InChI is InChI=1S/C21H16ClNO/c22-17-13-11-16(12-14-17)20-19(15-7-3-1-4-8-15)21(24)23(20)18-9-5-2-6-10-18/h1-14,19-20H/t19-,20-/m0/s1.
What are the key properties of (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one?
(3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one has a molecular weight of 333.82 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-(4-chlorophenyl)-1,3-diphenylazetidin-2-one is sourced from PubChem (CID 71385795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).