C24H33NO6P- — CID 71386400
benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] phosphate (PubChem CID 71386400) has the molecular formula C24H33NO6P- and a molecular weight of 462.50 g/mol. Its IUPAC name is benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] phosphate.
| Compound Name | benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] phosphate |
|---|---|
| PubChem CID | 71386400 |
| Molecular Formula | C24H33NO6P- |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] phosphate |
| SMILES | CN(Cc1ccccc1)C(CCOP(=O)([O-])OCc1ccccc1)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H34NO6P/c1-24(2)28-19-23(31-24)16-22(25(3)17-20-10-6-4-7-11-20)14-15-29-32(26,27)30-18-21-12-8-5-9-13-21/h4-13,22-23H,14-19H2,1-3H3,(H,26,27)/p-1 |
| InChIKey | OGOKDZCUVXPRKD-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|