C24H34NO6P — CID 71386401
benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] hydrogen phosphate (PubChem CID 71386401) has the molecular formula C24H34NO6P and a molecular weight of 463.51 g/mol. Its IUPAC name is benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] hydrogen phosphate.
| Compound Name | benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] hydrogen phosphate |
|---|---|
| PubChem CID | 71386401 |
| Molecular Formula | C24H34NO6P |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | benzyl [3-[benzyl(methyl)amino]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl] hydrogen phosphate |
| SMILES | CN(Cc1ccccc1)C(CCOP(=O)(O)OCc1ccccc1)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H34NO6P/c1-24(2)28-19-23(31-24)16-22(25(3)17-20-10-6-4-7-11-20)14-15-29-32(26,27)30-18-21-12-8-5-9-13-21/h4-13,22-23H,14-19H2,1-3H3,(H,26,27) |
| InChIKey | OGOKDZCUVXPRKD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|