About N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide
N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide (PubChem CID 71386780) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide |
| PubChem CID | 71386780 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide |
| SMILES | CCCC(=O)Nc1n[nH]c(C)n1 |
| InChI | InChI=1S/C7H12N4O/c1-3-4-6(12)9-7-8-5(2)10-11-7/h3-4H2,1-2H3,(H2,8,9,10,11,12) |
| InChIKey | IRPAZLSPMNBZMH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide?
The IUPAC name of N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide (CID 71386780) is N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide.
What is the SMILES notation for N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide?
The canonical SMILES for N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide is CCCC(=O)Nc1n[nH]c(C)n1.
What is the InChIKey of N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide?
The InChIKey is IRPAZLSPMNBZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-3-4-6(12)9-7-8-5(2)10-11-7/h3-4H2,1-2H3,(H2,8,9,10,11,12).
What are the key properties of N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide?
N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide has a molecular weight of 168.20 g/mol, XLogP of 0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1H-1,2,4-triazol-3-yl)butanamide is sourced from PubChem (CID 71386780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).