About [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate
[dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate (PubChem CID 71386975) has the molecular formula C11H16O3SSi
and a molecular weight of 256.40 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate |
| PubChem CID | 71386975 |
| Molecular Formula | C11H16O3SSi |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H16O3SSi/c1-4-10-15(12,13)14-16(2,3)11-8-6-5-7-9-11/h4-9H,1,10H2,2-3H3 |
| InChIKey | YNCCFNBHBPZQNY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate?
The IUPAC name of [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate (CID 71386975) is [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate.
What is the SMILES notation for [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate?
The canonical SMILES for [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate is C=CCS(=O)(=O)O[Si](C)(C)c1ccccc1.
What is the InChIKey of [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate?
The InChIKey is YNCCFNBHBPZQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3SSi/c1-4-10-15(12,13)14-16(2,3)11-8-6-5-7-9-11/h4-9H,1,10H2,2-3H3.
What are the key properties of [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate?
[dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate has a molecular weight of 256.40 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(phenyl)silyl] prop-2-ene-1-sulfonate is sourced from PubChem (CID 71386975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).