C18H18O2 — CID 71387659
3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-diol (PubChem CID 71387659) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-diol.
| Compound Name | 3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-diol |
|---|---|
| PubChem CID | 71387659 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-diol |
| SMILES | C#CC(C)=CC=CC(O)C#CC(O)C=CC=C(C)C#C |
| InChI | InChI=1S/C18H18O2/c1-5-15(3)9-7-11-17(19)13-14-18(20)12-8-10-16(4)6-2/h1-2,7-12,17-20H,3-4H3 |
| InChIKey | IJGMMMBPTDGERV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|