C18H14O2 — CID 71387660
3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-dione (PubChem CID 71387660) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-dione.
| Compound Name | 3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-dione |
|---|---|
| PubChem CID | 71387660 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3,14-dimethylhexadeca-3,5,11,13-tetraen-1,8,15-triyne-7,10-dione |
| SMILES | C#CC(C)=CC=CC(=O)C#CC(=O)C=CC=C(C)C#C |
| InChI | InChI=1S/C18H14O2/c1-5-15(3)9-7-11-17(19)13-14-18(20)12-8-10-16(4)6-2/h1-2,7-12H,3-4H3 |
| InChIKey | DXFUKRJFSCPCHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|