About (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol
(3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 7138780) has the molecular formula C12H25NO3S
and a molecular weight of 263.40 g/mol. Its IUPAC name is (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 7138780 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(C)CN(CC(C)C)[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C12H25NO3S/c1-9(2)5-13(6-10(3)4)11-7-17(15,16)8-12(11)14/h9-12,14H,5-8H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | IPCPIEXSPKHBPJ-VXGBXAGGSA-N |
| XLogP | 0.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol (CID 7138780) is (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol is CC(C)CN(CC(C)C)[C@@H]1CS(=O)(=O)C[C@H]1O.
What is the InChIKey of (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol?
The InChIKey is IPCPIEXSPKHBPJ-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H25NO3S/c1-9(2)5-13(6-10(3)4)11-7-17(15,16)8-12(11)14/h9-12,14H,5-8H2,1-4H3/t11-,12-/m1/s1.
What are the key properties of (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol?
(3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol has a molecular weight of 263.40 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-[bis(2-methylpropyl)amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 7138780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).