C11H12N2O5S2 — CID 7138801
(4aR,7aR)-1,1,6,6-tetraoxo-4-phenyl-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazin-3-one (PubChem CID 7138801) has the molecular formula C11H12N2O5S2 and a molecular weight of 316.36 g/mol. Its IUPAC name is (4aR,7aR)-1,1,6,6-tetraoxo-4-phenyl-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazin-3-one.
| Compound Name | (4aR,7aR)-1,1,6,6-tetraoxo-4-phenyl-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazin-3-one |
|---|---|
| PubChem CID | 7138801 |
| Molecular Formula | C11H12N2O5S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (4aR,7aR)-1,1,6,6-tetraoxo-4-phenyl-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazin-3-one |
| SMILES | O=C1NS(=O)(=O)[C@H]2CS(=O)(=O)C[C@H]2N1c1ccccc1 |
| InChI | InChI=1S/C11H12N2O5S2/c14-11-12-20(17,18)10-7-19(15,16)6-9(10)13(11)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,12,14)/t9-,10+/m1/s1 |
| InChIKey | PAKGPDMGILGSKD-ZJUUUORDSA-N |
| XLogP | -0.29 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |