C12H18Cl4O4 — CID 71388553
2-[5,5-bis(chloromethyl)-1,3-dioxan-2-yl]-5,5-bis(chloromethyl)-1,3-dioxane (PubChem CID 71388553) has the molecular formula C12H18Cl4O4 and a molecular weight of 368.08 g/mol. Its IUPAC name is 2-[5,5-bis(chloromethyl)-1,3-dioxan-2-yl]-5,5-bis(chloromethyl)-1,3-dioxane.
| Compound Name | 2-[5,5-bis(chloromethyl)-1,3-dioxan-2-yl]-5,5-bis(chloromethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 71388553 |
| Molecular Formula | C12H18Cl4O4 |
| Molecular Weight | 368.08 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-[5,5-bis(chloromethyl)-1,3-dioxan-2-yl]-5,5-bis(chloromethyl)-1,3-dioxane |
| SMILES | ClCC1(CCl)COC(C2OCC(CCl)(CCl)CO2)OC1 |
| InChI | InChI=1S/C12H18Cl4O4/c13-1-11(2-14)5-17-9(18-6-11)10-19-7-12(3-15,4-16)8-20-10/h9-10H,1-8H2 |
| InChIKey | VIPDVUXBSAZLAX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.08 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|