About diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate
diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate (PubChem CID 71388723) has the molecular formula C9H21O5P
and a molecular weight of 240.24 g/mol. Its IUPAC name is diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate.
Molecular Properties
| Compound Name | diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate |
| PubChem CID | 71388723 |
| Molecular Formula | C9H21O5P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate |
| SMILES | CCOP(=O)(OCC)OCC(C)(C)CO |
| InChI | InChI=1S/C9H21O5P/c1-5-12-15(11,13-6-2)14-8-9(3,4)7-10/h10H,5-8H2,1-4H3 |
| InChIKey | JMOPKMDKUKBLPB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate?
The IUPAC name of diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate (CID 71388723) is diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate.
What is the SMILES notation for diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate?
The canonical SMILES for diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate is CCOP(=O)(OCC)OCC(C)(C)CO.
What is the InChIKey of diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate?
The InChIKey is JMOPKMDKUKBLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O5P/c1-5-12-15(11,13-6-2)14-8-9(3,4)7-10/h10H,5-8H2,1-4H3.
What are the key properties of diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate?
diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate has a molecular weight of 240.24 g/mol, XLogP of 2.20, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (3-hydroxy-2,2-dimethylpropyl) phosphate is sourced from PubChem (CID 71388723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).