About ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate
ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate (PubChem CID 71388729) has the molecular formula C12H24O2S
and a molecular weight of 232.39 g/mol. Its IUPAC name is ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate |
| PubChem CID | 71388729 |
| Molecular Formula | C12H24O2S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(SC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24O2S/c1-8-14-10(13)9(11(2,3)4)15-12(5,6)7/h9H,8H2,1-7H3 |
| InChIKey | CRUOGQCOROZUKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate?
The IUPAC name of ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate (CID 71388729) is ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate is CCOC(=O)C(SC(C)(C)C)C(C)(C)C.
What is the InChIKey of ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate?
The InChIKey is CRUOGQCOROZUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S/c1-8-14-10(13)9(11(2,3)4)15-12(5,6)7/h9H,8H2,1-7H3.
What are the key properties of ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate?
ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate has a molecular weight of 232.39 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-tert-butylsulfanyl-3,3-dimethylbutanoate is sourced from PubChem (CID 71388729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).