C9H18ClNS — CID 71389042
3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-5-amine;hydrochloride (PubChem CID 71389042) has the molecular formula C9H18ClNS and a molecular weight of 207.77 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-5-amine;hydrochloride.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-5-amine;hydrochloride |
|---|---|
| PubChem CID | 71389042 |
| Molecular Formula | C9H18ClNS |
| Molecular Weight | 207.77 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-5-amine;hydrochloride |
| SMILES | Cl.NC1CCCC2SCCCC12 |
| InChI | InChI=1S/C9H17NS.ClH/c10-8-4-1-5-9-7(8)3-2-6-11-9;/h7-9H,1-6,10H2;1H |
| InChIKey | FFJBAWRFBJQJMH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |