About 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid
2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid (PubChem CID 71389262) has the molecular formula C8H22O8S2
and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid |
| PubChem CID | 71389262 |
| Molecular Formula | C8H22O8S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid |
| SMILES | CCC(C)(CO)CO.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C6H14O2.2CH4O3S/c1-3-6(2,4-7)5-8;2*1-5(2,3)4/h7-8H,3-5H2,1-2H3;2*1H3,(H,2,3,4) |
| InChIKey | LAFORTRIUHCOIC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid?
The IUPAC name of 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid (CID 71389262) is 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid.
What is the SMILES notation for 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid?
The canonical SMILES for 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid is CCC(C)(CO)CO.CS(=O)(=O)O.CS(=O)(=O)O.
What is the InChIKey of 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid?
The InChIKey is LAFORTRIUHCOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.2CH4O3S/c1-3-6(2,4-7)5-8;2*1-5(2,3)4/h7-8H,3-5H2,1-2H3;2*1H3,(H,2,3,4).
What are the key properties of 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid?
2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid has a molecular weight of 310.39 g/mol, XLogP of -0.60, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-methylpropane-1,3-diol;methanesulfonic acid is sourced from PubChem (CID 71389262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).