About 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane
2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane (PubChem CID 71389556) has the molecular formula C7H18Cl2Si2
and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane |
| PubChem CID | 71389556 |
| Molecular Formula | C7H18Cl2Si2 |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CC[SiH2]CC(Cl)Cl |
| InChI | InChI=1S/C7H18Cl2Si2/c1-11(2,3)5-4-10-6-7(8)9/h7H,4-6,10H2,1-3H3 |
| InChIKey | HBYQDAUTYNSTEQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane?
The IUPAC name of 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane (CID 71389556) is 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane.
What is the SMILES notation for 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane?
The canonical SMILES for 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane is C[Si](C)(C)CC[SiH2]CC(Cl)Cl.
What is the InChIKey of 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane?
The InChIKey is HBYQDAUTYNSTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18Cl2Si2/c1-11(2,3)5-4-10-6-7(8)9/h7H,4-6,10H2,1-3H3.
What are the key properties of 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane?
2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane has a molecular weight of 229.30 g/mol, XLogP of 3.13, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dichloroethylsilyl)ethyl-trimethylsilane is sourced from PubChem (CID 71389556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).